CAS 67656-29-5 appears in our catalog under these names: methylenetanshinquinone, 1-Methyl-6-methylene-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione, ≥98%, ≥98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 20mg.
1-methyl-6-methylidene-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione (CAS 67656-29-5) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: 1-methyl-6-methylidene-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione. InChIKey: QDFFAXSMLUUJSG-UHFFFAOYSA-N.
| Molecular formula | C18H14O3 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | 1-methyl-6-methylidene-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| InChIKey | QDFFAXSMLUUJSG-UHFFFAOYSA-N |
| SMILES | CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4=C |
Computed by PubChem (NCBI)