Products 149288-37-9

CAS 149288-37-9 is the registry number for 4-((Naphthalen-2-yloxy)methyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(naphthalen-2-yloxymethyl)benzoic acid (CAS 149288-37-9) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: 4-(naphthalen-2-yloxymethyl)benzoic acid. InChIKey: MCDIWKUXDMWKRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14O3
Molecular weight278.3 g/mol
IUPAC name4-(naphthalen-2-yloxymethyl)benzoic acid
InChIKeyMCDIWKUXDMWKRQ-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C=CC2=C1)OCC3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)