CAS 71481-05-5 is the registry number for 3,4-Dibenzylfuran-2,5-dione, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
3,4-dibenzylfuran-2,5-dione (CAS 71481-05-5) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: 3,4-dibenzylfuran-2,5-dione. InChIKey: LWCKJYBIJIELLM-UHFFFAOYSA-N.
| Molecular formula | C18H14O3 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | 3,4-dibenzylfuran-2,5-dione |
| InChIKey | LWCKJYBIJIELLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C(=O)OC2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)