Products 85966-09-2

CAS 85966-09-2 is the registry number for 2-Naphthyl 2-methoxybenzoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

Naphthalen-2-yl 2-methoxybenzoate (CAS 85966-09-2) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: naphthalen-2-yl 2-methoxybenzoate. InChIKey: PKZABVXLQDDLKF-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14O3
Molecular weight278.3 g/mol
IUPAC namenaphthalen-2-yl 2-methoxybenzoate
InChIKeyPKZABVXLQDDLKF-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1C(=O)OC2=CC3=CC=CC=C3C=C2

Computed by PubChem (NCBI)