Products 438465-54-4

CAS 438465-54-4 is the registry number for 3-((Naphthalen-1-yloxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

3-(naphthalen-1-yloxymethyl)benzoic acid (CAS 438465-54-4) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: 3-(naphthalen-1-yloxymethyl)benzoic acid. InChIKey: DNEWINHTWSXKJK-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14O3
Molecular weight278.3 g/mol
IUPAC name3-(naphthalen-1-yloxymethyl)benzoic acid
InChIKeyDNEWINHTWSXKJK-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2OCC3=CC(=CC=C3)C(=O)O

Computed by PubChem (NCBI)