Products 114829-18-4

CAS 114829-18-4 is the registry number for 4-Chloro-5-hydroxy-2-methylbenzofuran-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-chloro-5-hydroxy-2-methyl-1-benzofuran-3-carboxylic acid (CAS 114829-18-4) is a chemical compound with the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. IUPAC name: 4-chloro-5-hydroxy-2-methyl-1-benzofuran-3-carboxylic acid. InChIKey: LMMHHIPPKLWJIL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7ClO4
Molecular weight226.61 g/mol
IUPAC name4-chloro-5-hydroxy-2-methyl-1-benzofuran-3-carboxylic acid
InChIKeyLMMHHIPPKLWJIL-UHFFFAOYSA-N
SMILESCC1=C(C2=C(O1)C=CC(=C2Cl)O)C(=O)O

Computed by PubChem (NCBI)