CAS 19149-43-0 is the registry number for 3-Chloro-7,8-dihydroxy-4-methyl-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-7,8-dihydroxy-4-methylchromen-2-one (CAS 19149-43-0) is a chemical compound with the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. IUPAC name: 3-chloro-7,8-dihydroxy-4-methylchromen-2-one. InChIKey: QAZKNKBOVBHCEU-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO4 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | 3-chloro-7,8-dihydroxy-4-methylchromen-2-one |
| InChIKey | QAZKNKBOVBHCEU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2O)O)Cl |
Computed by PubChem (NCBI)