Products 1352542-16-5
CAS 1352542-16-5 is the registry number for 2-((5-Chlorobenzofuran-6-yl)oxy)acetic acid. Offered by: Biosynth. Available pack sizes: 1g.
2-[(5-chloro-1-benzofuran-6-yl)oxy]acetic acid (CAS 1352542-16-5) is a chemical compound with the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. IUPAC name: 2-[(5-chloro-1-benzofuran-6-yl)oxy]acetic acid. InChIKey: AKLMISKWQNNSGE-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO4 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | 2-[(5-chloro-1-benzofuran-6-yl)oxy]acetic acid |
| InChIKey | AKLMISKWQNNSGE-UHFFFAOYSA-N |
| SMILES | C1=COC2=CC(=C(C=C21)Cl)OCC(=O)O |
Computed by PubChem (NCBI)