CAS 52011-76-4 appears in our catalog under these names: 6-Chloro-4-oxochroman-2-carboxylic acid, 97%, 6-Chloro-4-oxo-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-chloro-4-oxo-2,3-dihydrochromene-2-carboxylic acid (CAS 52011-76-4) is a chemical compound with the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. IUPAC name: 6-chloro-4-oxo-2,3-dihydrochromene-2-carboxylic acid. InChIKey: RJNYIXPGUIVGJT-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO4 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | 6-chloro-4-oxo-2,3-dihydrochromene-2-carboxylic acid |
| InChIKey | RJNYIXPGUIVGJT-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(C1=O)C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)