Products 809234-33-1
CAS 809234-33-1 appears in our catalog under these names: DNA polymerase-IN-1, DNA polymerase-IN-1/ 99%, 4-(Chloromethyl)-5,7-dihydroxy-2H-chromen-2-one. Offered by: MedChemExpress, TargetMol, Chemat. Available pack sizes: 5 mg, 10 mg, 25 mg, 1 mg, 1mg, 5mg, 10mg, 25mg.
4-(chloromethyl)-5,7-dihydroxychromen-2-one (CAS 809234-33-1) is a chemical compound with the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. IUPAC name: 4-(chloromethyl)-5,7-dihydroxychromen-2-one. InChIKey: SMMCGQQUJPNVBJ-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO4 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | 4-(chloromethyl)-5,7-dihydroxychromen-2-one |
| InChIKey | SMMCGQQUJPNVBJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1O)C(=CC(=O)O2)CCl)O |
Computed by PubChem (NCBI)