Products 38053-20-2
CAS 38053-20-2 is the registry number for 4-(4-Chlorophenyl)-2,4-dioxobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-chlorophenyl)-2,4-dioxobutanoic acid (CAS 38053-20-2) is a chemical compound with the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. IUPAC name: 4-(4-chlorophenyl)-2,4-dioxobutanoic acid. InChIKey: REKRWOUHJMMFBQ-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO4 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2,4-dioxobutanoic acid |
| InChIKey | REKRWOUHJMMFBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)C(=O)O)Cl |
Computed by PubChem (NCBI)