CAS 951902-52-6 is the registry number for 6-Chloro-1-oxo-isochroman-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid (CAS 951902-52-6) is a chemical compound with the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. IUPAC name: 6-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid. InChIKey: DVIYHAUVAWYWJW-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO4 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | 6-chloro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid |
| InChIKey | DVIYHAUVAWYWJW-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)C2=C1C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)