CAS 1633931-69-7 is the registry number for 3-(7-Chloro-2H-1,3-benzodioxol-5-yl)prop-2-enoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoic acid (CAS 1633931-69-7) is a chemical compound with the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. IUPAC name: (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoic acid. InChIKey: JVQAFDBYQZAWNY-OWOJBTEDSA-N.
| Molecular formula | C10H7ClO4 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoic acid |
| InChIKey | JVQAFDBYQZAWNY-OWOJBTEDSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)