Products 460044-74-0
CAS 460044-74-0 is the registry number for 5-Chloro-7-methoxy-1-benzofuran-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
5-chloro-7-methoxy-1-benzofuran-2-carboxylic acid (CAS 460044-74-0) is a chemical compound with the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. IUPAC name: 5-chloro-7-methoxy-1-benzofuran-2-carboxylic acid. InChIKey: SJIWXWCGQMFLNE-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO4 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | 5-chloro-7-methoxy-1-benzofuran-2-carboxylic acid |
| InChIKey | SJIWXWCGQMFLNE-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)Cl)C=C(O2)C(=O)O |
Computed by PubChem (NCBI)