Products 1152531-95-7
CAS 1152531-95-7 appears in our catalog under these names: 3-(2,6-Difluorophenyl)-1,2-Oxazole-5-Carboxylic Acid, 95%+, 3-(2,6-Difluorophenyl)-1,2-oxazole-5-carboxylic acid. Offered by: Chemat, Fluorochem, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 50mg.
3-(2,6-difluorophenyl)-1,2-oxazole-5-carboxylic acid (CAS 1152531-95-7) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 3-(2,6-difluorophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: KFNLXJCGJPSLIF-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO3 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 3-(2,6-difluorophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | KFNLXJCGJPSLIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=NOC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)