Products 1152548-65-6

CAS 1152548-65-6 is the registry number for 3-(2,5-Difluorophenyl)-1-methyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(2,5-difluorophenyl)-1-methylpyrazole-4-carboxylic acid (CAS 1152548-65-6) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 3-(2,5-difluorophenyl)-1-methylpyrazole-4-carboxylic acid. InChIKey: AXDQBQOZVFEFSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8F2N2O2
Molecular weight238.19 g/mol
IUPAC name3-(2,5-difluorophenyl)-1-methylpyrazole-4-carboxylic acid
InChIKeyAXDQBQOZVFEFSZ-UHFFFAOYSA-N
SMILESCN1C=C(C(=N1)C2=C(C=CC(=C2)F)F)C(=O)O

Computed by PubChem (NCBI)