CAS 1152548-65-6 is the registry number for 3-(2,5-Difluorophenyl)-1-methyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,5-difluorophenyl)-1-methylpyrazole-4-carboxylic acid (CAS 1152548-65-6) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 3-(2,5-difluorophenyl)-1-methylpyrazole-4-carboxylic acid. InChIKey: AXDQBQOZVFEFSZ-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O2 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)-1-methylpyrazole-4-carboxylic acid |
| InChIKey | AXDQBQOZVFEFSZ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2=C(C=CC(=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)