CAS 1153234-13-9 is the registry number for 3-Bromo-4-(difluoromethoxy)-5-ethoxybenzaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-bromo-4-(difluoromethoxy)-5-ethoxybenzaldehyde (CAS 1153234-13-9) is a chemical compound with the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. IUPAC name: 3-bromo-4-(difluoromethoxy)-5-ethoxybenzaldehyde. InChIKey: HAGRESFVZPNRMJ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O3 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | 3-bromo-4-(difluoromethoxy)-5-ethoxybenzaldehyde |
| InChIKey | HAGRESFVZPNRMJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C=O)Br)OC(F)F |
Computed by PubChem (NCBI)