CAS 2122218-35-1 is the registry number for Ethyl 5-bromo-2,3-difluoro-4-methoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
Ethyl 5-bromo-2,3-difluoro-4-methoxybenzoate (CAS 2122218-35-1) is a chemical compound with the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. IUPAC name: ethyl 5-bromo-2,3-difluoro-4-methoxybenzoate. InChIKey: URESHCPKOBQPGV-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O3 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | ethyl 5-bromo-2,3-difluoro-4-methoxybenzoate |
| InChIKey | URESHCPKOBQPGV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1F)F)OC)Br |
Computed by PubChem (NCBI)