Products 1694272-40-6
CAS 1694272-40-6 is the registry number for 1-(4-Bromo-2,5-dimethoxyphenyl)-2,2-difluoroethan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromo-2,5-dimethoxyphenyl)-2,2-difluoroethanone (CAS 1694272-40-6) is a chemical compound with the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. IUPAC name: 1-(4-bromo-2,5-dimethoxyphenyl)-2,2-difluoroethanone. InChIKey: CFVWDZVJFASDCR-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O3 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | 1-(4-bromo-2,5-dimethoxyphenyl)-2,2-difluoroethanone |
| InChIKey | CFVWDZVJFASDCR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)C(F)F)OC)Br |
Computed by PubChem (NCBI)