Products 2168634-16-8
CAS 2168634-16-8 is the registry number for 2-(4-Bromo-2,6-difluoro-phenoxy)-2-methyl-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-bromo-2,6-difluorophenoxy)-2-methylpropanoic acid (CAS 2168634-16-8) is a chemical compound with the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. IUPAC name: 2-(4-bromo-2,6-difluorophenoxy)-2-methylpropanoic acid. InChIKey: ILMPFNXZKIFLTH-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O3 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | 2-(4-bromo-2,6-difluorophenoxy)-2-methylpropanoic acid |
| InChIKey | ILMPFNXZKIFLTH-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=C(C=C(C=C1F)Br)F |
Computed by PubChem (NCBI)