CAS 2586125-77-9 is the registry number for 5-Bromo-2,3-difluoro-4-isopropoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-bromo-2,3-difluoro-4-propan-2-yloxybenzoic acid (CAS 2586125-77-9) is a chemical compound with the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. IUPAC name: 5-bromo-2,3-difluoro-4-propan-2-yloxybenzoic acid. InChIKey: FISUOHOIYKBMQF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O3 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | 5-bromo-2,3-difluoro-4-propan-2-yloxybenzoic acid |
| InChIKey | FISUOHOIYKBMQF-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C(=C1F)F)C(=O)O)Br |
Computed by PubChem (NCBI)