CAS 1255707-62-0 is the registry number for 4-Bromo-3-(2,2-difluoro-ethoxy)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 4-bromo-3-(2,2-difluoroethoxy)benzoate (CAS 1255707-62-0) is a chemical compound with the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. IUPAC name: methyl 4-bromo-3-(2,2-difluoroethoxy)benzoate. InChIKey: YYKIOCNIWCNJOV-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O3 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | methyl 4-bromo-3-(2,2-difluoroethoxy)benzoate |
| InChIKey | YYKIOCNIWCNJOV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)OCC(F)F |
Computed by PubChem (NCBI)