CAS 2484889-01-0 is the registry number for Methyl 5-bromo-4-ethoxy-2,3-difluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 5-bromo-4-ethoxy-2,3-difluorobenzoate (CAS 2484889-01-0) is a chemical compound with the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. IUPAC name: methyl 5-bromo-4-ethoxy-2,3-difluorobenzoate. InChIKey: POBXNPMSBYGNMX-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O3 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | methyl 5-bromo-4-ethoxy-2,3-difluorobenzoate |
| InChIKey | POBXNPMSBYGNMX-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1F)F)C(=O)OC)Br |
Computed by PubChem (NCBI)