Products 149169-71-1
CAS 149169-71-1 is the registry number for 2–Bromo–1–(4–(difluoromethoxy)–3–methoxyphenyl)ethan–1–one. Offered by: GLPBio. Available pack sizes: 100mg.
2-bromo-1-[4-(difluoromethoxy)-3-methoxyphenyl]ethanone (CAS 149169-71-1) is a chemical compound with the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. IUPAC name: 2-bromo-1-[4-(difluoromethoxy)-3-methoxyphenyl]ethanone. InChIKey: WIDVLGSAZFBORY-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O3 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | 2-bromo-1-[4-(difluoromethoxy)-3-methoxyphenyl]ethanone |
| InChIKey | WIDVLGSAZFBORY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)CBr)OC(F)F |
Computed by PubChem (NCBI)