CAS 2710966-64-4 is the registry number for 3-Bromo-4-(difluoromethoxy)-5-ethylbenzoic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-4-(difluoromethoxy)-5-ethylbenzoic acid (CAS 2710966-64-4) is a chemical compound with the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. IUPAC name: 3-bromo-4-(difluoromethoxy)-5-ethylbenzoic acid. InChIKey: YYEPUFCJEGERQT-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O3 |
|---|---|
| Molecular weight | 295.08 g/mol |
| IUPAC name | 3-bromo-4-(difluoromethoxy)-5-ethylbenzoic acid |
| InChIKey | YYEPUFCJEGERQT-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC(=C1)C(=O)O)Br)OC(F)F |
Computed by PubChem (NCBI)