CAS 1153977-31-1 appears in our catalog under these names: 3-(3-Chlorophenyl)-1,2,4-thiadiazol-5-amine, 95%, 3-(3-Chlorophenyl)-1,2,4-thiadiazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
3-(3-chlorophenyl)-1,2,4-thiadiazol-5-amine (CAS 1153977-31-1) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 3-(3-chlorophenyl)-1,2,4-thiadiazol-5-amine. InChIKey: HKUJGFWNXMTAPM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | HKUJGFWNXMTAPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NSC(=N2)N |
Computed by PubChem (NCBI)