CAS 1156491-08-5 is the registry number for rac-(1R,2S)-2-(2,4-Difluorophenyl)cyclopropan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Trans-(1R,2S)-2-(2,4-difluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1156491-08-5) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: trans-(1R,2S)-2-(2,4-difluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: WTXYKXBHDMJYAB-DKXTVVGFSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | trans-(1R,2S)-2-(2,4-difluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | WTXYKXBHDMJYAB-DKXTVVGFSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=C(C=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)