CAS 1157096-49-5 is the registry number for 1,3-Dimethyl-5-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-4-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,3-dimethyl-5-(1,2,4-triazol-1-yl)pyrazol-4-amine (CAS 1157096-49-5) is a chemical compound with the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. IUPAC name: 1,3-dimethyl-5-(1,2,4-triazol-1-yl)pyrazol-4-amine. InChIKey: QRRPEWSRUJGFOF-UHFFFAOYSA-N.
| Molecular formula | C7H10N6 |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 1,3-dimethyl-5-(1,2,4-triazol-1-yl)pyrazol-4-amine |
| InChIKey | QRRPEWSRUJGFOF-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1N)N2C=NC=N2)C |
Computed by PubChem (NCBI)