CAS 5434-23-1 is the registry number for N2,N2-Dimethyl-9H-purine-2,6-diamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-N,2-N-dimethyl-7H-purine-2,6-diamine (CAS 5434-23-1) is a chemical compound with the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. IUPAC name: 2-N,2-N-dimethyl-7H-purine-2,6-diamine. InChIKey: ZMIYNNVNJUDTED-UHFFFAOYSA-N.
| Molecular formula | C7H10N6 |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 2-N,2-N-dimethyl-7H-purine-2,6-diamine |
| InChIKey | ZMIYNNVNJUDTED-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=C2C(=N1)N=CN2)N |
Computed by PubChem (NCBI)