CAS 5437-49-0 appears in our catalog under these names: N6,N6-Dimethyl-9H-purine-2,6-diamine, 95%, N6,N6-Dimethyl-9H-purine-2,6-diamine, N6,N6-Dimethyl-9H-purine-2,6-diamine, min. 95 %, 50 mg, N6,N6-Dimethyl-9H-purine-2,6-diamine, min. 95 %, 100 mg, N6,N6-Dimethyl-9H-purine-2,6-diamine, min. 95 %, 250 mg. Offered by: AmBeed, Biosynth, Roth. Available pack sizes: 10g, 50mg, 100mg, 250mg, 500mg, 1000mg.
6-N,6-N-dimethyl-7H-purine-2,6-diamine (CAS 5437-49-0) is a chemical compound with the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. IUPAC name: 6-N,6-N-dimethyl-7H-purine-2,6-diamine. InChIKey: GHILAORILZRWPO-UHFFFAOYSA-N.
| Molecular formula | C7H10N6 |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 6-N,6-N-dimethyl-7H-purine-2,6-diamine |
| InChIKey | GHILAORILZRWPO-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NC2=C1NC=N2)N |
Computed by PubChem (NCBI)