CAS 1277174-15-8 is the registry number for 3-(1,3-Dimethyl-1H-pyrazol-5-yl)-1H-1,2,4-triazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,5-dimethylpyrazol-3-yl)-1H-1,2,4-triazol-3-amine (CAS 1277174-15-8) is a chemical compound with the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. IUPAC name: 5-(2,5-dimethylpyrazol-3-yl)-1H-1,2,4-triazol-3-amine. InChIKey: KJVZYNJAABZIOG-UHFFFAOYSA-N.
| Molecular formula | C7H10N6 |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 5-(2,5-dimethylpyrazol-3-yl)-1H-1,2,4-triazol-3-amine |
| InChIKey | KJVZYNJAABZIOG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C2=NC(=NN2)N)C |
Computed by PubChem (NCBI)