CAS 2168779-79-9 is the registry number for 3-(Propan-2-yl)-3H-(1,2,3)triazolo(4,5-d)pyrimidin-7-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine (CAS 2168779-79-9) is a chemical compound with the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. IUPAC name: 3-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine. InChIKey: SNRRUVSDZBYKMB-UHFFFAOYSA-N.
| Molecular formula | C7H10N6 |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 3-propan-2-yltriazolo[4,5-d]pyrimidin-7-amine |
| InChIKey | SNRRUVSDZBYKMB-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=NC=NC(=C2N=N1)N |
Computed by PubChem (NCBI)