CAS 86111-67-3 is the registry number for 1-((3-Amino-1H-pyrazol-1-yl)methyl)-1H-pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(3-aminopyrazol-1-yl)methyl]pyrazol-3-amine (CAS 86111-67-3) is a chemical compound with the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. IUPAC name: 1-[(3-aminopyrazol-1-yl)methyl]pyrazol-3-amine. InChIKey: RAXKXQVCMYTLFG-UHFFFAOYSA-N.
| Molecular formula | C7H10N6 |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 1-[(3-aminopyrazol-1-yl)methyl]pyrazol-3-amine |
| InChIKey | RAXKXQVCMYTLFG-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1N)CN2C=CC(=N2)N |
Computed by PubChem (NCBI)