CAS 6288-92-2 is the registry number for 4-Hydrazinyl-1,6-dimethyl-1h-pyrazolo(3,4-d)pyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine (CAS 6288-92-2) is a chemical compound with the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. IUPAC name: (1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine. InChIKey: CAJFOFKKMPXQGA-UHFFFAOYSA-N.
| Molecular formula | C7H10N6 |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | (1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)hydrazine |
| InChIKey | CAJFOFKKMPXQGA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C2C=NN(C2=N1)C)NN |
Computed by PubChem (NCBI)