CAS 21320-38-7 is the registry number for [4-Amino-6-(dimethylamino)-1,3,5-triazin-2-yl]acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]acetonitrile (CAS 21320-38-7) is a chemical compound with the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. IUPAC name: 2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]acetonitrile. InChIKey: MOVYTPJXZBDDBN-UHFFFAOYSA-N.
| Molecular formula | C7H10N6 |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]acetonitrile |
| InChIKey | MOVYTPJXZBDDBN-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NC(=N1)N)CC#N |
Computed by PubChem (NCBI)