CAS 40293-19-4 appears in our catalog under these names: 9-(2-Aminoethyl)-9H-purin-6-amine, 98%, 9-(2-Aminoethyl)-9H-purin-6-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 0,5g, 50mg.
9-(2-aminoethyl)purin-6-amine (CAS 40293-19-4) is a chemical compound with the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. IUPAC name: 9-(2-aminoethyl)purin-6-amine. InChIKey: WWGYBDUMTIQRLK-UHFFFAOYSA-N.
| Molecular formula | C7H10N6 |
|---|---|
| Molecular weight | 178.20 g/mol |
| IUPAC name | 9-(2-aminoethyl)purin-6-amine |
| InChIKey | WWGYBDUMTIQRLK-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)CCN)N |
Computed by PubChem (NCBI)