Products 1157945-03-3

CAS 1157945-03-3 is the registry number for 3-{((5-Bromofuran-2-yl)methyl)amino}-4-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-[(5-bromofuran-2-yl)methylamino]-4-methylbenzoic acid (CAS 1157945-03-3) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: 3-[(5-bromofuran-2-yl)methylamino]-4-methylbenzoic acid. InChIKey: YINGNFQMZBILBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12BrNO3
Molecular weight310.14 g/mol
IUPAC name3-[(5-bromofuran-2-yl)methylamino]-4-methylbenzoic acid
InChIKeyYINGNFQMZBILBQ-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(=O)O)NCC2=CC=C(O2)Br

Computed by PubChem (NCBI)