CAS 1157945-03-3 is the registry number for 3-{((5-Bromofuran-2-yl)methyl)amino}-4-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[(5-bromofuran-2-yl)methylamino]-4-methylbenzoic acid (CAS 1157945-03-3) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: 3-[(5-bromofuran-2-yl)methylamino]-4-methylbenzoic acid. InChIKey: YINGNFQMZBILBQ-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | 3-[(5-bromofuran-2-yl)methylamino]-4-methylbenzoic acid |
| InChIKey | YINGNFQMZBILBQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)NCC2=CC=C(O2)Br |
Computed by PubChem (NCBI)