CAS 1159831-34-1 is the registry number for Imidazo[1,5-a]quinoline-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Imidazo[1,5-a]quinoline-1-carboxylic acid (CAS 1159831-34-1) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: imidazo[1,5-a]quinoline-1-carboxylic acid. InChIKey: NYQHVEMNWDKZKI-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | imidazo[1,5-a]quinoline-1-carboxylic acid |
| InChIKey | NYQHVEMNWDKZKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=CN=C(N32)C(=O)O |
Computed by PubChem (NCBI)