Products 1159981-28-8

CAS 1159981-28-8 is the registry number for 5-Methyl-3-(4-phenoxyphenyl)isoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-methyl-3-(4-phenoxyphenyl)-1,2-oxazole-4-carboxylic acid (CAS 1159981-28-8) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 5-methyl-3-(4-phenoxyphenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: KLCQGWRPAGSQEA-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13NO4
Molecular weight295.29 g/mol
IUPAC name5-methyl-3-(4-phenoxyphenyl)-1,2-oxazole-4-carboxylic acid
InChIKeyKLCQGWRPAGSQEA-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=CC=C(C=C2)OC3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)