Products 116-69-8
CAS 116-69-8 appears in our catalog under these names: 3-Bromophthalic acid, 95%, 3-Bromophthalic acid, 97%, 3-Bromophthalic Acid, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 50g, 100g, 250g.
3-bromophthalic acid (CAS 116-69-8) is a chemical compound with the molecular formula C8H5BrO4 and a molecular weight of 245.03 g/mol. IUPAC name: 3-bromophthalic acid. InChIKey: OIGFNQRFPUUACU-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO4 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 3-bromophthalic acid |
| InChIKey | OIGFNQRFPUUACU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)