CAS 6939-93-1 appears in our catalog under these names: 4-Bromoisophthalic Acid, 4–Bromoisophthalic acid, 4-Bromoisophthalic acid, 96% , 4-Bromoisophthalic Acid, >97.0%(GC)(T), 4-Bromoisophthalic acid 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 5g, 100g, 10g, 25g, 0,025kg, 0,01kg, 0,05kg, 0,1kg.
4-bromobenzene-1,3-dicarboxylic acid (CAS 6939-93-1) is a chemical compound with the molecular formula C8H5BrO4 and a molecular weight of 245.03 g/mol. IUPAC name: 4-bromobenzene-1,3-dicarboxylic acid. InChIKey: MSQIEZXCNYUWHN-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO4 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 4-bromobenzene-1,3-dicarboxylic acid |
| InChIKey | MSQIEZXCNYUWHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)Br |
Computed by PubChem (NCBI)