CAS 72744-57-1 appears in our catalog under these names: 6-Bromobenzo(d)(1,3)dioxole-4-carboxylic acid, 97%, 6-Bromo-1,3-dioxaindane-4-carboxylic acid, 6-Bromobenzo[d][1,3]dioxole-4-carboxylic acid, 97%, 97%, 6-Bromobenzo[d][1,3]dioxole-4-carboxylic acid, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
6-bromo-1,3-benzodioxole-4-carboxylic acid (CAS 72744-57-1) is a chemical compound with the molecular formula C8H5BrO4 and a molecular weight of 245.03 g/mol. IUPAC name: 6-bromo-1,3-benzodioxole-4-carboxylic acid. InChIKey: QLRIAHYAWFMMSW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO4 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 6-bromo-1,3-benzodioxole-4-carboxylic acid |
| InChIKey | QLRIAHYAWFMMSW-UHFFFAOYSA-N |
| SMILES | C1OC2=CC(=CC(=C2O1)C(=O)O)Br |
Computed by PubChem (NCBI)