CAS 60546-62-5 appears in our catalog under these names: 6-Bromobenzo-(1,3)-dioxole-5-carboxylic acid, 6-Bromo-3,4-methylenedioxybenzoic acid, 95%, 6–Bromobenzo(d)(1,3)dioxole–5–carboxylic Acid, 6-Bromobenzo[d][1,3]dioxole-5-carboxylic acid 98%, 6-Bromobenzo[d][1,3]dioxole-5-carboxylic Acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 2g, 1g, 5g, 250mg, 100mg, 10g.
6-bromo-1,3-benzodioxole-5-carboxylic acid (CAS 60546-62-5) is a chemical compound with the molecular formula C8H5BrO4 and a molecular weight of 245.03 g/mol. IUPAC name: 6-bromo-1,3-benzodioxole-5-carboxylic acid. InChIKey: NRFYLBBOKXFHMO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO4 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 6-bromo-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | NRFYLBBOKXFHMO-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)