CAS 586-35-6 appears in our catalog under these names: 2–Bromoterephthalic acid, 2-Bromoterephthalic acid, 97% , 2-Bromoterephthalic acid, 95%, Bromoterephthalic Acid, >98.0%(GC), 2-Bromoterephthalic acid 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI, Ambeed. Available pack sizes: 100g, 25g, 500g, 5g, 1000g, 1g, 10g, 1kg.
2-bromoterephthalic acid (CAS 586-35-6) is a chemical compound with the molecular formula C8H5BrO4 and a molecular weight of 245.03 g/mol. IUPAC name: 2-bromoterephthalic acid. InChIKey: QPBGNSFASPVGTP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO4 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 2-bromoterephthalic acid |
| InChIKey | QPBGNSFASPVGTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)C(=O)O |
Computed by PubChem (NCBI)