CAS 22433-91-6 appears in our catalog under these names: 2–bromobenzene–1,3–dicarboxylic acid, 2-Bromobenzene-1,3-dicarboxylic acid, 2-Bromoisophthalic acid 97%, 2-Bromoisophthalic acid, 95%, 95%, 2-Bromoisophthalic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 50g, 25g, 100g, 100mg, 10g.
2-bromobenzene-1,3-dicarboxylic acid (CAS 22433-91-6) is a chemical compound with the molecular formula C8H5BrO4 and a molecular weight of 245.03 g/mol. IUPAC name: 2-bromobenzene-1,3-dicarboxylic acid. InChIKey: LOICBODWTPYJIW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO4 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 2-bromobenzene-1,3-dicarboxylic acid |
| InChIKey | LOICBODWTPYJIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)Br)C(=O)O |
Computed by PubChem (NCBI)