CAS 23351-91-9 appears in our catalog under these names: 5-Bromoisophthalic Acid, >98.0%(GC)(T), 5-Bromoisophthalic acid, 5-Bromoisophthalic acid 97%, 5-Bromoisophthalic acid, 97%. Offered by: TCI, Biosynth, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 1000g.
5-bromobenzene-1,3-dicarboxylic acid (CAS 23351-91-9) is a chemical compound with the molecular formula C8H5BrO4 and a molecular weight of 245.03 g/mol. IUPAC name: 5-bromobenzene-1,3-dicarboxylic acid. InChIKey: JATKASGNRMGFSW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO4 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 5-bromobenzene-1,3-dicarboxylic acid |
| InChIKey | JATKASGNRMGFSW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)Br)C(=O)O |
Computed by PubChem (NCBI)