CAS 72744-56-0 appears in our catalog under these names: 5-Bromobenzo[1,3]dioxole-4-carboxylic acid, 95%, 5–Bromobenzo(d)(1,3)dioxole–4–carboxylic acid, 5-Bromo-1,3-dioxaindane-4-carboxylic acid, 5-Bromobenzo[d][1,3]dioxole-4-carboxylic acid 97%, 5-Bromobenzo[1,3]dioxole-4-carboxylic acid, 95%+, 95%+. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 100g, 250mg, 25g, 100mg.
5-bromo-1,3-benzodioxole-4-carboxylic acid (CAS 72744-56-0) is a chemical compound with the molecular formula C8H5BrO4 and a molecular weight of 245.03 g/mol. IUPAC name: 5-bromo-1,3-benzodioxole-4-carboxylic acid. InChIKey: HDNXEXSQANVCKC-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO4 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 5-bromo-1,3-benzodioxole-4-carboxylic acid |
| InChIKey | HDNXEXSQANVCKC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)