CAS 6968-28-1 appears in our catalog under these names: 4–Bromophthalic acid, 4-Bromophthalic acid, 98% , 4-Bromophthalic Acid, >98.0%(T), 4-Bromophthalic acid 98%, 4-Bromophthalic acid, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g.
4-bromophthalic acid (CAS 6968-28-1) is a chemical compound with the molecular formula C8H5BrO4 and a molecular weight of 245.03 g/mol. IUPAC name: 4-bromophthalic acid. InChIKey: AZXKGUVDIORSED-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO4 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 4-bromophthalic acid |
| InChIKey | AZXKGUVDIORSED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)