Products 1160573-70-5
CAS 1160573-70-5 is the registry number for 2,3-Dichloro-5-fluorobenzoic acid, 97%. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2,3-dichloro-5-fluorobenzoic acid (CAS 1160573-70-5) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 2,3-dichloro-5-fluorobenzoic acid. InChIKey: SLWTYJRNTBVPLO-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO2 |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 2,3-dichloro-5-fluorobenzoic acid |
| InChIKey | SLWTYJRNTBVPLO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)Cl)F |
Computed by PubChem (NCBI)