Products 1160574-77-5
CAS 1160574-77-5 appears in our catalog under these names: Methyl 3-bromo-4,5-dichlorobenzoate, 98%, Methyl 3-bromo-4,5-dichlorobenzoate, 95%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
Methyl 3-bromo-4,5-dichlorobenzoate (CAS 1160574-77-5) is a chemical compound with the molecular formula C8H5BrCl2O2 and a molecular weight of 283.93 g/mol. IUPAC name: methyl 3-bromo-4,5-dichlorobenzoate. InChIKey: ANUDICAWMRTDOZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2O2 |
|---|---|
| Molecular weight | 283.93 g/mol |
| IUPAC name | methyl 3-bromo-4,5-dichlorobenzoate |
| InChIKey | ANUDICAWMRTDOZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)Cl)Cl |
Computed by PubChem (NCBI)